CymitQuimica logo

CAS 898782-52-0

:

Cyclopropyl[2-(4-thiomorpholinylmethyl)phenyl]methanone

Description:
Cyclopropyl[2-(4-thiomorpholinylmethyl)phenyl]methanone is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a thiomorpholine moiety. The presence of the cyclopropyl group contributes to the compound's rigidity and may influence its reactivity and biological activity. The thiomorpholine ring, which contains sulfur, can enhance the compound's interaction with biological targets, potentially affecting its pharmacological properties. This compound is likely to exhibit moderate to high lipophilicity due to the presence of aromatic and aliphatic groups, which can influence its solubility and permeability in biological systems. Additionally, the methanone functional group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Overall, the structural characteristics of Cyclopropyl[2-(4-thiomorpholinylmethyl)phenyl]methanone suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C15H19NOS
InChI:InChI=1S/C15H19NOS/c17-15(12-5-6-12)14-4-2-1-3-13(14)11-16-7-9-18-10-8-16/h1-4,12H,5-11H2
InChI key:InChIKey=ADVSKYIHIKPPIQ-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2CC2)C=CC=C1)N3CCSCC3
Synonyms:
  • Cyclopropyl[2-(4-thiomorpholinylmethyl)phenyl]methanone
  • Methanone, cyclopropyl[2-(4-thiomorpholinylmethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.