CAS 898782-54-2

Cyclobutyl[2-(4-thiomorpholinylmethyl)phenyl]methanone

Description:

Cyclobutyl[2-(4-thiomorpholinylmethyl)phenyl]methanone, identified by its CAS number 898782-54-2, is a synthetic organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, contributing to its rigidity and potential strain effects. The presence of a thiomorpholine moiety introduces a sulfur atom into the structure, enhancing its chemical reactivity and potentially influencing its biological activity. The compound also features a phenyl group, which can participate in π-π interactions, affecting its solubility and interaction with other molecules. This compound may exhibit interesting pharmacological properties due to its complex structure, making it a candidate for research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its properties can be influenced by factors such as steric hindrance and electronic effects from the substituents. Overall, Cyclobutyl[2-(4-thiomorpholinylmethyl)phenyl]methanone represents a class of compounds that could be valuable in drug development and materials science.

Formula: C₁₆H₂₁NOS

InChI: InChI=1S/C16H21NOS/c18-16(13-5-3-6-13)15-7-2-1-4-14(15)12-17-8-10-19-11-9-17/h1-2,4,7,13H,3,5-6,8-12H2

InChI key: InChIKey=JTWZAHGLSICEPN-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2CCC2)C=CC=C1)N3CCSCC3

Synonyms:

• Cyclobutyl[2-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, cyclobutyl[2-(4-thiomorpholinylmethyl)phenyl]-