CAS 898782-58-6

cyclohexyl-[2-(thiomorpholinomethyl)phenyl]methanone

Description:

Cyclohexyl-[2-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898782-58-6, is a chemical compound characterized by its unique structure that includes a cyclohexyl group, a thiomorpholine moiety, and a phenyl ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility and reactivity. The presence of the thiomorpholine group suggests potential for interactions typical of sulfur-containing compounds, such as nucleophilicity or coordination with metal ions. Additionally, the methanone functional group indicates that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The compound's molecular structure may impart specific biological activities, making it of interest in pharmaceutical research. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, such as melting point, boiling point, and spectral characteristics, as well as its potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₈H₂₅NOS

InChI: InChI=1/C18H25NOS/c20-18(15-6-2-1-3-7-15)17-9-5-4-8-16(17)14-19-10-12-21-13-11-19/h4-5,8-9,15H,1-3,6-7,10-14H2

SMILES: C1CCC(CC1)C(=O)c1ccccc1CN1CCSCC1