CAS 898782-59-7

Methanone, (3-bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3-bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom at the 3-position of one phenyl ring contributes to its reactivity and potential applications in organic synthesis. The compound also features a thiomorpholine moiety, which introduces a sulfur atom into the structure, enhancing its potential for biological activity and interaction with various biological targets. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, making it of interest in medicinal chemistry and drug development. Overall, the unique combination of bromine, sulfur, and aromatic systems in this compound may lead to interesting pharmacological properties, warranting further investigation in research settings.

Formula: C₁₈H₁₈BrNOS

InChI: InChI=1S/C18H18BrNOS/c19-17-3-1-2-16(12-17)18(21)15-6-4-14(5-7-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=KQCMEQKHEUBUJY-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• (3-Bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (3-bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
• 3-Bromo-4′-thiomorpholinomethyl benzophenone

3-bromo-4′-thiomorpholinomethyl benzophenone

CAS: 898782-59-7

Formula: C₁₈H₁₈BrNOS

Purity: 97.0%

Molecular weight: 376.31

Ref: 10-F204499