CAS 898782-61-1
:Methanone, (4-bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
Description:
Methanone, (4-bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom on one of the phenyl rings contributes to its reactivity and potential applications in various chemical reactions. The thiomorpholine moiety introduces a sulfur atom into the structure, which can enhance the compound's biological activity and solubility properties. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, including stability under certain conditions and potential for engaging in electrophilic substitution reactions. Its unique combination of functional groups may make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific interactions between its functional groups and the surrounding environment. Safety and handling precautions should be observed due to the presence of bromine and sulfur in its structure.
Formula:C18H18BrNOS
InChI:InChI=1S/C18H18BrNOS/c19-17-7-5-16(6-8-17)18(21)15-3-1-14(2-4-15)13-20-9-11-22-12-10-20/h1-8H,9-13H2
InChI key:InChIKey=LJGOEBPFRCVSMU-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(Br)C=C3
Synonyms:- 4-Bromo-4′-thiomorpholinomethyl benzophenone
- Methanone, (4-bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
- (4-Bromophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.