CymitQuimica logo

CAS 898782-62-2

:

ethyl 5-oxo-5-[2-(thiomorpholinomethyl)phenyl]pentanoate

Description:
Ethyl 5-oxo-5-[2-(thiomorpholinomethyl)phenyl]pentanoate, with the CAS number 898782-62-2, is a synthetic organic compound characterized by its complex structure, which includes an ester functional group and a thiomorpholine moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the thiomorpholine ring suggests potential biological activity, as thiomorpholines are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound may exhibit moderate to high stability under standard conditions, but its reactivity can vary based on the presence of functional groups and environmental factors. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact.
Formula:C18H25NO3S
InChI:InChI=1/C18H25NO3S/c1-2-22-18(21)9-5-8-17(20)16-7-4-3-6-15(16)14-19-10-12-23-13-11-19/h3-4,6-7H,2,5,8-14H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1ccccc1CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.