CAS 898782-63-3

Methanone, (3-chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3-chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chlorophenyl group indicates that it has a chlorine atom substituted on a phenyl ring, which can influence its reactivity and solubility. The compound also features a thiomorpholine moiety, suggesting potential interactions with biological systems, as thiomorpholines are often involved in medicinal chemistry. This compound may exhibit properties such as moderate to high lipophilicity due to its aromatic components, which can affect its bioavailability and pharmacokinetics. Additionally, the presence of multiple functional groups may contribute to its potential as a ligand in various chemical reactions or as a candidate in drug development. Overall, the unique combination of structural elements in this compound suggests it may have interesting chemical and biological properties, warranting further investigation in relevant fields such as pharmaceuticals or materials science.

Formula: C₁₈H₁₈ClNOS

InChI: InChI=1/C18H18ClNOS/c19-17-3-1-2-16(12-17)18(21)15-6-4-14(5-7-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=VZDJOXNOZIMGEI-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• 3-Chloro-4′-thiomorpholinomethyl benzophenone
• (3-Chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (3-chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

3-chloro-4′-thiomorpholinomethyl benzophenone

CAS: 898782-63-3

Formula: C₁₈H₁₈ClNOS

Purity: 97.0%

Molecular weight: 331.86

Ref: 10-F204501