CAS 898782-64-4

ethyl 6-oxo-6-[2-(thiomorpholinomethyl)phenyl]hexanoate

Description:

Ethyl 6-oxo-6-[2-(thiomorpholinomethyl)phenyl]hexanoate, identified by its CAS number 898782-64-4, is a chemical compound that features a complex structure incorporating both an ester and a ketone functional group. This compound is characterized by its ethyl ester moiety, which contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The presence of the thiomorpholine ring introduces a nitrogen atom, enhancing its potential for biological activity and interaction with biological systems. The phenyl group attached to the thiomorpholine adds to the compound's lipophilicity, which may influence its pharmacokinetic properties. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₉H₂₇NO₃S

InChI: InChI=1/C19H27NO3S/c1-2-23-19(22)10-6-5-9-18(21)17-8-4-3-7-16(17)15-20-11-13-24-14-12-20/h3-4,7-8H,2,5-6,9-15H2,1H3

SMILES: CCOC(=O)CCCCC(=O)c1ccccc1CN1CCSCC1