CAS 898782-65-5
:(4-chlorophenyl)-[4-(thiomorpholinomethyl)phenyl]methanone
Description:
(4-chlorophenyl)-[4-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898782-65-5, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a thiomorpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic chemistry, making it of interest in medicinal chemistry and drug development. The presence of the chlorophenyl moiety may contribute to its biological activity, potentially influencing its interactions with biological targets. The thiomorpholine ring introduces a sulfur atom, which can enhance the compound's solubility and reactivity. As with many compounds containing halogens and heterocycles, it may exhibit specific pharmacological properties, including antimicrobial or anticancer activities, although detailed biological data would be necessary to confirm such effects. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds and those containing sulfur. Overall, this compound represents a class of molecules that may have significant applications in pharmaceutical research.
Formula:C18H18ClNOS
InChI:InChI=1/C18H18ClNOS/c19-17-7-5-16(6-8-17)18(21)15-3-1-14(2-4-15)13-20-9-11-22-12-10-20/h1-8H,9-13H2
SMILES:c1cc(ccc1CN1CCSCC1)C(=O)c1ccc(cc1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.