CAS 898782-66-6
:ethyl 7-oxo-7-[2-(thiomorpholinomethyl)phenyl]heptanoate
Description:
Ethyl 7-oxo-7-[2-(thiomorpholinomethyl)phenyl]heptanoate is a synthetic organic compound characterized by its complex structure, which includes an ester functional group, a ketone, and a thiomorpholine moiety. The presence of the ethyl ester indicates that it is likely to be a liquid at room temperature, exhibiting moderate volatility. The ketone group contributes to its reactivity, making it a potential candidate for various chemical transformations. The thiomorpholine ring introduces a heterocyclic element, which can enhance the compound's biological activity and solubility in organic solvents. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C20H29NO3S
InChI:InChI=1/C20H29NO3S/c1-2-24-20(23)11-5-3-4-10-19(22)18-9-7-6-8-17(18)16-21-12-14-25-15-13-21/h6-9H,2-5,10-16H2,1H3
SMILES:CCOC(=O)CCCCCC(=O)c1ccccc1CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.