CymitQuimica logo

CAS 898782-67-7

:

(3-fluorophenyl)-[4-(thiomorpholinomethyl)phenyl]methanone

Description:
(3-fluorophenyl)-[4-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898782-67-7, is a synthetic organic compound characterized by its complex molecular structure. It features a ketone functional group, which is indicative of its potential reactivity and ability to participate in various chemical reactions. The presence of a fluorine atom in the 3-position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which may contribute to unique pharmacological properties, such as improved binding affinity to biological targets. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological systems. Its solubility, stability, and reactivity would depend on the specific conditions of use, including solvent choice and temperature. As with many synthetic compounds, safety and handling precautions should be observed, given the potential hazards associated with its chemical structure.
Formula:C18H18FNOS
InChI:InChI=1/C18H18FNOS/c19-17-3-1-2-16(12-17)18(21)15-6-4-14(5-7-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2
SMILES:c1cc(cc(c1)F)C(=O)c1ccc(cc1)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.