CAS 898782-70-2
:[2-[(4-methylpiperazin-1-yl)methyl]phenyl]-(o-tolyl)methanone
Description:
The chemical substance known as [2-[(4-methylpiperazin-1-yl)methyl]phenyl]-(o-tolyl)methanone, with the CAS number 898782-70-2, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring, a piperazine moiety, and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit moderate to high lipophilicity due to the aromatic components, influencing its solubility and permeability in biological systems. Additionally, the presence of substituents such as the methyl group on the piperazine and the o-tolyl group can affect its reactivity and interaction with other molecules. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a research chemical, although specific biological activities would require further investigation.
Formula:C20H24N2O
InChI:InChI=1/C20H24N2O/c1-16-7-3-5-9-18(16)20(23)19-10-6-4-8-17(19)15-22-13-11-21(2)12-14-22/h3-10H,11-15H2,1-2H3
SMILES:Cc1ccccc1C(=O)c1ccccc1CN1CCN(C)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.