CAS 898782-71-3

Methanone, (2,3-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2,3-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,3-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, which can influence its reactivity and solubility. The compound also features a thiomorpholine moiety, which is a six-membered ring containing sulfur and nitrogen, contributing to its potential biological activity. This compound may exhibit properties such as moderate to high lipophilicity due to its aromatic components, which can affect its interaction with biological systems. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, making it of interest in medicinal chemistry and drug design. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₀H₂₃NOS

InChI: InChI=1/C20H23NOS/c1-15-4-3-5-19(16(15)2)20(22)18-8-6-17(7-9-18)14-21-10-12-23-13-11-21/h3-9H,10-14H2,1-2H3

InChI key: InChIKey=CWVOULCMRXEDCY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C(C)=CC=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• Methanone, (2,3-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
• 2,3-Dimethyl-4′-thiomorpholinomethyl benzophenone
• (2,3-Dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone

2,3-dimethyl-4′-thiomorpholinomethyl benzophenone

CAS: 898782-71-3

Formula: C₂₀H₂₃NOS

Purity: 97.0%

Molecular weight: 325.47

Ref: 10-F204505