CAS 898782-72-4

Methanone, (3-methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3-methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a piperazine moiety suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. This compound features a 3-methylphenyl group and a 4-methyl-1-piperazinyl group, indicating that it may exhibit lipophilic characteristics, which can influence its solubility and interaction with biological membranes. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, depending on the conditions. Additionally, the compound's specific stereochemistry and substituent positions can significantly affect its reactivity and biological activity. Overall, Methanone, (3-methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is of interest in medicinal chemistry and may have applications in drug development, particularly in the context of neuropharmacology or other therapeutic areas.

Formula: C₂₀H₂₄N₂O

InChI: InChI=1/C20H24N2O/c1-16-6-5-8-17(14-16)20(23)19-9-4-3-7-18(19)15-22-12-10-21(2)11-13-22/h3-9,14H,10-13,15H2,1-2H3

InChI key: InChIKey=WVUPBNIAFRKWMS-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=CC(C)=CC=C3

Synonyms:

• 3′-Methyl-2-(4-methylpiperazinomethyl) benzophenone
• Methanone, (3-methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (3-Methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

3′-methyl-2-(4-methylpiperazinomethyl) benzophenone

CAS: 898782-72-4

Formula: C₂₀H₂₄N₂O

Purity: 97.0%

Molecular weight: 308.425

Ref: 10-F205453