CymitQuimica logo

CAS 898782-73-5

:

Methanone, (2,4-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:
Methanone, (2,4-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,4-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, which can influence its reactivity and solubility. The compound also features a thiomorpholine moiety, suggesting potential applications in medicinal chemistry due to the presence of sulfur and nitrogen in its structure, which can enhance biological activity. This compound may exhibit properties such as moderate to high lipophilicity, making it suitable for interactions with biological membranes. Additionally, its unique arrangement of functional groups could lead to interesting electronic properties and reactivity patterns. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as temperature and pH. Overall, this compound represents a class of molecules that may have potential applications in pharmaceuticals or materials science.
Formula:C20H23NOS
InChI:InChI=1/C20H23NOS/c1-15-3-8-19(16(2)13-15)20(22)18-6-4-17(5-7-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3
InChI key:InChIKey=FLABIXCZCKLAMH-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=C(C)C=C1)C2=CC=C(CN3CCSCC3)C=C2
Synonyms:
  • (2,4-Dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
  • 2,4-Dimethyl-4′-thiomorpholinomethyl benzophenone
  • Methanone, (2,4-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.