CAS 898782-74-6

Methanone, (4-methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and a piperazine moiety. This compound features a phenyl ring substituted with a methyl group at the para position, contributing to its aromatic properties. The presence of the piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms, suggests potential biological activity, as piperazine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound's molecular structure indicates it may exhibit lipophilicity due to the aromatic rings, which can influence its solubility and interaction with biological membranes. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it a candidate for further synthetic modifications. Overall, this compound's unique characteristics position it as a subject of interest in both chemical research and potential therapeutic applications.

Formula: C₂₀H₂₄N₂O

InChI: InChI=1S/C20H24N2O/c1-16-7-9-17(10-8-16)20(23)19-6-4-3-5-18(19)15-22-13-11-21(2)12-14-22/h3-10H,11-15H2,1-2H3

InChI key: InChIKey=XFDHXKNPMYLMJH-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=CC=C(C)C=C3

Synonyms:

• (4-Methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• 4′-Methyl-2-(4-methylpiperazinomethyl )benzophenone
• Methanone, (4-methylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

4′-methyl-2-(4-methylpiperazinomethyl) benzophenone

CAS: 898782-74-6

Formula: C₂₀H₂₄N₂O

Purity: 97.0%

Molecular weight: 308.425

Ref: 10-F205454