CAS 898782-76-8
:(2-methoxyphenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone
Description:
The chemical substance known as (2-methoxyphenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898782-76-8, is a synthetic organic compound characterized by its complex structure, which includes a methoxy group and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. Its molecular structure suggests it may interact with biological targets, possibly influencing neurotransmitter systems due to the presence of the piperazine ring, which is often found in pharmacologically active compounds. The presence of the methoxyphenyl groups may enhance lipophilicity, affecting its pharmacokinetic properties. Additionally, the compound may undergo various chemical reactions, including oxidation and substitution, depending on the conditions. Overall, this substance represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of psychiatry and neurology, although specific biological activity would require empirical investigation.
Formula:C20H24N2O2
InChI:InChI=1/C20H24N2O2/c1-21-11-13-22(14-12-21)15-16-7-3-4-8-17(16)20(23)18-9-5-6-10-19(18)24-2/h3-10H,11-15H2,1-2H3
SMILES:CN1CCN(CC1)Cc1ccccc1C(=O)c1ccccc1OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.