CAS 898782-77-9
:Methanone, (2,6-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
Description:
Methanone, (2,6-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,6-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, enhancing its hydrophobic characteristics. The compound also features a thiomorpholine moiety, which introduces a sulfur atom into the structure, potentially affecting its reactivity and solubility. This compound is likely to exhibit properties typical of both ketones and aromatic compounds, such as stability under standard conditions and potential reactivity in electrophilic substitution reactions. Its unique structure may confer specific biological activities, making it of interest in medicinal chemistry. However, detailed information regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization. Overall, this compound exemplifies the diversity of organic chemistry and the potential for complex interactions in biological systems.
Formula:C20H23NOS
InChI:InChI=1/C20H23NOS/c1-15-4-3-5-16(2)19(15)20(22)18-8-6-17(7-9-18)14-21-10-12-23-13-11-21/h3-9H,10-14H2,1-2H3
InChI key:InChIKey=IDPOJAIKOLCHMQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCSCC2)C=C1)C3=C(C)C=CC=C3C
Synonyms:- 2,6-Dimethyl-4′-thiomorpholinomethyl benzophenone
- (2,6-Dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
- Methanone, (2,6-dimethylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
- (2,6-Dimethylphenyl)(4-(thiomorpholinomethyl)phenyl)methanone
- (2,6-dimethylphenyl)-[4-(thiomorpholin-4-ylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.