CymitQuimica logo

CAS 898782-78-0

:

Methanone, (3-methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:
Methanone, (3-methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a methoxy group (–OCH3) on one of the phenyl rings enhances its solubility and reactivity. The compound also features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, contributing to its potential biological activity. This structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. The compound's molecular architecture indicates potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions, given the piperazine's common use in such contexts. Additionally, the presence of substituents like the methyl group on the piperazine may influence its pharmacokinetic properties, such as absorption and metabolism. Overall, this compound exemplifies the intricate relationship between chemical structure and biological function, warranting further investigation for its therapeutic potential.
Formula:C20H24N2O2
InChI:InChI=1S/C20H24N2O2/c1-21-10-12-22(13-11-21)15-17-6-3-4-9-19(17)20(23)16-7-5-8-18(14-16)24-2/h3-9,14H,10-13,15H2,1-2H3
InChI key:InChIKey=WJIASZDEUZRVJD-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=CC(OC)=CC=C2)C=CC=C1)N3CCN(C)CC3
Synonyms:
  • (3-Methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
  • Methanone, (3-methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-
  • 3′-Methoxy-2-(4-methylpiperazinomethyl) benzophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.