CAS 898782-80-4

Methanone, (4-methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 4-methoxyphenyl group indicates that it has a methoxy (-OCH3) substituent on a phenyl ring, contributing to its potential for various interactions in biological systems. Additionally, the compound features a piperazine moiety, which is known for its role in pharmacological activity, particularly in the development of psychoactive drugs. The piperazine ring is substituted with a methyl group, enhancing its lipophilicity and possibly influencing its binding affinity to biological targets. Overall, this compound may exhibit interesting properties due to its structural features, making it a candidate for research in medicinal chemistry and drug development. However, specific biological activities, solubility, and stability would require further investigation through empirical studies.

Formula: C₂₀H₂₄N₂O₂

InChI: InChI=1S/C20H24N2O2/c1-21-11-13-22(14-12-21)15-17-5-3-4-6-19(17)20(23)16-7-9-18(24-2)10-8-16/h3-10H,11-15H2,1-2H3

InChI key: InChIKey=SWCLJAWBLUNBCT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=CC=C(OC)C=C3

Synonyms:

• (4-Methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (4-methoxyphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• 4′-Methoxy-2-(4-methylpiperazinomethyl) benzophenone