CAS 898782-83-7

(4-bromo-3-fluoro-phenyl)-[4-(thiomorpholinomethyl)phenyl]methanone

Description:

(4-bromo-3-fluoro-phenyl)-[4-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898782-83-7, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with bromine and fluorine atoms, as well as a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its unique functional groups. The presence of the bromine and fluorine substituents can influence its reactivity, solubility, and interaction with biological targets. The thiomorpholine group may contribute to its pharmacological properties, potentially enhancing its ability to interact with specific receptors or enzymes. As a result, compounds of this nature are often studied for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its specific physical and chemical properties, such as melting point, boiling point, and solubility, would be necessary to fully characterize its behavior in various environments.

Formula: C₁₈H₁₇BrFNOS

InChI: InChI=1/C18H17BrFNOS/c19-16-6-5-15(11-17(16)20)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

SMILES: c1cc(ccc1CN1CCSCC1)C(=O)c1ccc(c(c1)F)Br

4-bromo-3-fluoro-4′-thiomorpholinomethyl benzophenone

CAS: 898782-83-7

Formula: C₁₈H₁₇BrFNOS

Purity: 97.0%

Molecular weight: 394.3

Ref: 10-F204511