CAS 898782-85-9

Methanone, (4-chloro-3-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-3-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique chemical reactivity and potential biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which can enhance solubility and influence pharmacokinetic properties. This compound may exhibit interesting properties such as potential antimicrobial or anticancer activity, making it a subject of interest in medicinal chemistry. Its molecular interactions are likely influenced by the electron-withdrawing effects of the halogen substituents and the steric effects of the thiomorpholine group. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₈H₁₇ClFNOS

InChI: InChI=1S/C18H17ClFNOS/c19-16-6-5-15(11-17(16)20)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=ICTUXUMKIGBACQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(Cl)C=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• (4-Chloro-3-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (4-chloro-3-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

4-chloro-3-fluoro-4′-thiomorpholinomethyl benzophenone

CAS: 898782-85-9

Formula: C₁₈H₁₇ClFNOS

Purity: 97.0%

Molecular weight: 349.85

Ref: 10-F204512