CAS 898782-87-1

Methanone, (3-chloro-4-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl ring indicates that it may exhibit unique electronic properties, potentially influencing its reactivity and interactions with biological targets. The thiomorpholine moiety suggests that the compound may possess interesting pharmacological properties, as thiomorpholines are often found in various bioactive molecules. This compound is likely to be a solid at room temperature, given its structural characteristics, and may have moderate solubility in organic solvents. Its molecular structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable chemical databases for precise applications and handling guidelines.

Formula: C₁₈H₁₇ClFNOS

InChI: InChI=1S/C18H17ClFNOS/c19-16-11-15(5-6-17(16)20)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=GXBCOVJBDSQUHA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(F)C=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• Methanone, (3-chloro-4-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
• 3-Chloro-4-fluoro-4′-thiomorpholinomethyl benzophenone

3-chloro-4-fluoro-4′-thiomorpholinomethyl benzophenone

CAS: 898782-87-1

Formula: C₁₈H₁₇ClFNOS

Purity: 97.0%

Molecular weight: 349.85

Ref: 10-F204513