CymitQuimica logo

CAS 898782-88-2

:

3-(1,3-dioxan-2-yl)-1-(3-phenoxyphenyl)propan-1-one

Description:
3-(1,3-Dioxan-2-yl)-1-(3-phenoxyphenyl)propan-1-one, with the CAS number 898782-88-2, is an organic compound characterized by its complex structure, which includes a dioxane ring and a phenoxyphenyl moiety. This compound typically exhibits properties associated with both ketones and ethers due to the presence of the carbonyl group and the dioxane ring. It is likely to be a solid at room temperature, with potential solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic components. The presence of the dioxane ring may impart stability and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and materials science. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry contexts. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C19H20O4
InChI:InChI=1/C19H20O4/c20-18(10-11-19-21-12-5-13-22-19)15-6-4-9-17(14-15)23-16-7-2-1-3-8-16/h1-4,6-9,14,19H,5,10-13H2
SMILES:c1ccc(cc1)Oc1cccc(c1)C(=O)CCC1OCCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.