CAS 898782-89-3

Ethyl 2-[2-[(4-methyl-1-piperazinyl)methyl]benzoyl]benzoate

Description:

Ethyl 2-[2-[(4-methyl-1-piperazinyl)methyl]benzoyl]benzoate, identified by its CAS number 898782-89-3, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester group, a benzoyl moiety, and a piperazine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in organic solvents. The presence of the piperazine ring suggests possible biological activity, as piperazine derivatives are often explored for their pharmacological properties. Ethyl 2-[2-[(4-methyl-1-piperazinyl)methyl]benzoyl]benzoate may also display moderate to high melting and boiling points, indicative of its molecular weight and structural complexity. Additionally, its functional groups may allow for various chemical reactions, making it a candidate for further research in medicinal chemistry or material science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₂₂H₂₆N₂O₃

InChI: InChI=1S/C22H26N2O3/c1-3-27-22(26)20-11-7-6-10-19(20)21(25)18-9-5-4-8-17(18)16-24-14-12-23(2)13-15-24/h4-11H,3,12-16H2,1-2H3

InChI key: InChIKey=WZHCEWQDOQTITI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(OCC)=O)C=CC=C1)C2=C(CN3CCN(C)CC3)C=CC=C2

Synonyms:

• Benzoic acid, 2-[2-[(4-methyl-1-piperazinyl)methyl]benzoyl]-, ethyl ester
• Ethyl 2-[2-[(4-methyl-1-piperazinyl)methyl]benzoyl]benzoate

2-carboethoxy-2′-(4-methylpiperazinomethyl) benzophenone

CAS: 898782-89-3

Formula: C₂₂H₂₆N₂O₃

Purity: 97.0%

Molecular weight: 366.461

Ref: 10-F205461