CAS 898782-90-6

Methanone, (2-chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2-chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 2-chlorophenyl group indicates that there is a chlorine atom substituted on the second position of a phenyl ring, contributing to its reactivity and potential biological activity. Additionally, the compound features a thiomorpholine moiety, which is a six-membered ring containing sulfur and nitrogen, suggesting potential interactions with biological systems. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological membranes. The presence of multiple functional groups may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the unique combination of structural elements in this compound may lead to interesting chemical behavior and biological activity, warranting further investigation in research settings.

Formula: C₁₈H₁₈ClNOS

InChI: InChI=1/C18H18ClNOS/c19-17-4-2-1-3-16(17)18(21)15-7-5-14(6-8-15)13-20-9-11-22-12-10-20/h1-8H,9-13H2

InChI key: InChIKey=MGNYEHPOYUKQAN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCSCC2)C=C1)C3=C(Cl)C=CC=C3

Synonyms:

• Methanone, (2-chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
• 2-Chloro-4′-thiomorpholinomethyl benzophenone
• (2-Chlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone

2-chloro-4′-thiomorpholinomethyl benzophenone

CAS: 898782-90-6

Formula: C₁₈H₁₈ClNOS

Purity: 97.0%

Molecular weight: 331.86

Ref: 10-F204514