CymitQuimica logo

CAS 898782-91-7

:

4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(3-phenoxyphenyl)-1-butanone

Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(3-phenoxyphenyl)-1-butanone, with the CAS number 898782-91-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and a phenoxyphenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic molecules with large aromatic systems. It may possess functional groups that contribute to its reactivity, making it suitable for various applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the dioxane moiety suggests potential stability under certain conditions, while the phenyl groups may impart specific electronic properties. Additionally, the compound's structure may influence its biological activity, making it of interest in medicinal chemistry. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C22H26O4
InChI:InChI=1S/C22H26O4/c1-22(2)15-24-21(25-16-22)13-7-12-20(23)17-8-6-11-19(14-17)26-18-9-4-3-5-10-18/h3-6,8-11,14,21H,7,12-13,15-16H2,1-2H3
InChI key:InChIKey=WNFFUHDZYVGKQW-UHFFFAOYSA-N
SMILES:O(C1=CC(C(CCCC2OCC(C)(C)CO2)=O)=CC=C1)C3=CC=CC=C3
Synonyms:
  • 4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(3-phenoxyphenyl)-1-butanone
  • 1-Butanone, 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(3-phenoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.