CAS 898782-94-0
:5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(3-phenoxyphenyl)pentan-1-one
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(3-phenoxyphenyl)pentan-1-one, with the CAS number 898782-94-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a pentanone backbone and a dioxane ring. This compound features a phenoxyphenyl substituent, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the dioxane moiety suggests that it may exhibit unique solubility and stability properties, while the pentanone structure indicates potential reactivity typical of ketones. Its molecular design may allow for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of bulky dimethyl groups can influence its steric properties, potentially affecting its biological activity and interactions. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules, with implications for research and development in chemical and pharmaceutical industries.
Formula:C23H28O4
InChI:InChI=1/C23H28O4/c1-23(2)16-25-22(26-17-23)14-7-6-13-21(24)18-9-8-12-20(15-18)27-19-10-4-3-5-11-19/h3-5,8-12,15,22H,6-7,13-14,16-17H2,1-2H3
SMILES:CC1(C)COC(CCCCC(=O)c2cccc(c2)Oc2ccccc2)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.