CymitQuimica logo

CAS 898783-01-2

:

(3-bromophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:
The chemical substance known as (3-bromophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898783-01-2, is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the bromine atom may enhance lipophilicity and influence the compound's interaction with biological targets. The piperazine ring is known for its role in pharmacology, often contributing to the modulation of neurotransmitter systems. As a ketone, it features a carbonyl group that can participate in various chemical reactions, including nucleophilic attacks. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or formulations.
Formula:C19H21BrN2O
InChI:InChI=1/C19H21BrN2O/c1-21-9-11-22(12-10-21)14-16-5-2-3-8-18(16)19(23)15-6-4-7-17(20)13-15/h2-8,13H,9-12,14H2,1H3
SMILES:CN1CCN(CC1)Cc1ccccc1C(=O)c1cccc(c1)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.