CAS 898783-02-3

(4-bromo-2-fluoro-phenyl)-[4-(thiomorpholinomethyl)phenyl]methanone

Description:

(4-bromo-2-fluoro-phenyl)-[4-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898783-02-3, is a synthetic organic compound characterized by its complex molecular structure. It features a phenyl ring substituted with both bromine and fluorine atoms, which contribute to its unique electronic properties and potential reactivity. The presence of a thiomorpholine moiety indicates that the compound may exhibit interesting pharmacological properties, as thiomorpholines are often associated with biological activity. The methanone functional group suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound's structural features may influence its solubility, stability, and interaction with biological targets, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its potential applications could span fields such as drug development or materials science, depending on its specific properties and behavior in biological systems.

Formula: C₁₈H₁₇BrFNOS

InChI: InChI=1/C18H17BrFNOS/c19-15-5-6-16(17(20)11-15)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

SMILES: c1cc(ccc1CN1CCSCC1)C(=O)c1ccc(cc1F)Br

4-bromo-2-fluoro-4′-thiomorpholinomethyl benzophenone

CAS: 898783-02-3

Formula: C₁₈H₁₇BrFNOS

Purity: 97.0%

Molecular weight: 394.3

Ref: 10-F204519