CAS 898783-04-5

Methanone, (2-chloro-4-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2-chloro-4-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique reactivity and potential biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which can enhance the compound's pharmacological properties, potentially influencing its interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in areas such as drug design, where modifications to the aromatic and heterocyclic components can lead to variations in activity and selectivity. As with many synthetic compounds, understanding its solubility, stability, and reactivity under various conditions is crucial for its practical applications. Safety and handling considerations are also important, given the presence of halogenated substituents, which can pose environmental and health risks.

Formula: C₁₈H₁₇ClFNOS

InChI: InChI=1/C18H17ClFNOS/c19-17-11-15(20)5-6-16(17)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=GEFBZFKRYIRXFT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(F)C=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• (2-Chloro-4-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
• 2-Chloro-4-fluoro-4′-thiomorpholinomethyl benzophenone
• Methanone, (2-chloro-4-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-