CAS 898783-06-7

Methanone, (3-chloro-5-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The thiomorpholine moiety introduces a heterocyclic element, which may enhance its solubility and interaction with biological targets. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in areas such as drug design, where modifications to the aromatic and heterocyclic components can lead to variations in efficacy and selectivity. As with many synthetic compounds, understanding its stability, solubility, and interaction with other molecules is crucial for its application in research and industry. Safety and handling precautions should be observed due to the presence of halogenated substituents, which can affect toxicity and environmental impact.

Formula: C₁₈H₁₇ClFNOS

InChI: InChI=1S/C18H17ClFNOS/c19-16-9-15(10-17(20)11-16)18(22)14-3-1-13(2-4-14)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2

InChI key: InChIKey=IJMJBVBSFMQJEU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(F)=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• (3-Chloro-5-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (3-chloro-5-fluorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-