CAS 898783-07-8
:(4-chlorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone
Description:
The chemical substance known as (4-chlorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898783-07-8, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and a piperazine moiety. This compound features a chlorinated phenyl group, which can influence its biological activity and lipophilicity. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is likely to exhibit moderate to high solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic rings. Additionally, the presence of the piperazine group may impart basic properties, affecting its ionization and reactivity. Overall, this compound's unique structural features contribute to its potential applications in drug discovery and development, particularly in targeting specific receptors or enzymes in biological systems.
Formula:C19H21ClN2O
InChI:InChI=1/C19H21ClN2O/c1-21-10-12-22(13-11-21)14-16-4-2-3-5-18(16)19(23)15-6-8-17(20)9-7-15/h2-9H,10-14H2,1H3
SMILES:CN1CCN(CC1)Cc1ccccc1C(=O)c1ccc(cc1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.