CAS 898783-08-9
:(4-chloro-2-fluoro-phenyl)-[4-(thiomorpholinomethyl)phenyl]methanone
Description:
The chemical substance known as (4-chloro-2-fluoro-phenyl)-[4-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898783-08-9, is a synthetic organic compound characterized by its complex molecular structure. It features a phenyl ring substituted with both a chloro and a fluoro group, which can influence its reactivity and biological activity. The presence of a thiomorpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The methanone functional group indicates that the compound may exhibit ketone-like properties, contributing to its reactivity. Additionally, the compound's structural features may impart specific solubility and stability characteristics, which are crucial for its performance in various chemical environments. Overall, this compound's unique combination of functional groups and substituents makes it a subject of interest for further research, particularly in the fields of drug design and development.
Formula:C18H17ClFNOS
InChI:InChI=1/C18H17ClFNOS/c19-15-5-6-16(17(20)11-15)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2
SMILES:c1cc(ccc1CN1CCSCC1)C(=O)c1ccc(cc1F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.