CAS 898783-11-4

Methanone, (4-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 4-fluorophenyl group indicates that it has a fluorine atom substituted on the phenyl ring, which can influence its reactivity and biological activity. Additionally, the compound features a piperazine moiety, specifically a 4-methyl-1-piperazinyl group, which is known for its role in various pharmacological activities. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. The compound's molecular interactions may be affected by the electron-withdrawing nature of the fluorine atom and the steric effects of the piperazine ring. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, making it a subject of interest in drug discovery and development.

Formula: C₁₉H₂₁FN₂O

InChI: InChI=1S/C19H21FN2O/c1-21-10-12-22(13-11-21)14-16-4-2-3-5-18(16)19(23)15-6-8-17(20)9-7-15/h2-9H,10-14H2,1H3

InChI key: InChIKey=OQNFJXWQGNMWGP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=CC=C(F)C=C3

Synonyms:

• 4′-Fluoro-2-(4-methylpiperazinomethyl) benzophenone
• Methanone, (4-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

4′-fluoro-2-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-11-4

Formula: C₁₉H₂₁FN₂O

Purity: 97.0%

Molecular weight: 312.388

Ref: 10-F205471