CAS 898783-12-5

Methanone, (2,4-dichlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and physical properties. The thiomorpholine moiety introduces a sulfur atom into the structure, contributing to its potential biological activity and solubility characteristics. This compound may exhibit properties typical of both ketones and aromatic compounds, such as varying degrees of polarity and potential for hydrogen bonding. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly for its potential interactions with biological targets. As with many organic compounds, its stability, reactivity, and biological activity would depend on the specific conditions under which it is studied, including solvent, temperature, and the presence of other reactive species.

Formula: C₁₈H₁₇Cl₂NOS

InChI: InChI=1S/C18H17Cl2NOS/c19-15-5-6-16(17(20)11-15)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=NHKIDFQMVLTUDT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• Methanone, (2,4-dichlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
• (2,4-Dichlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone