CAS 898783-18-1

Methanone, (3,5-dichlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-dichlorophenyl group indicates that the compound has chlorine substituents at the 3 and 5 positions of the phenyl ring, contributing to its electronic properties and potential reactivity. Additionally, the compound features a thiomorpholine moiety, which is a six-membered ring containing sulfur and nitrogen, suggesting potential applications in medicinal chemistry due to its ability to interact with biological systems. The overall structure implies that it may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in various biochemical pathways. Its molecular complexity and the presence of heteroatoms may also influence its solubility, stability, and interaction with other chemical entities. As with many such compounds, further studies would be necessary to fully elucidate its properties and potential applications in research or industry.

Formula: C₁₈H₁₇Cl₂NOS

InChI: InChI=1S/C18H17Cl2NOS/c19-16-9-15(10-17(20)11-16)18(22)14-3-1-13(2-4-14)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2

InChI key: InChIKey=WZFGJVMEYUJRCC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC=C(CN3CCSCC3)C=C2

Synonyms:

• 3,5-Dichloro-4′-thiomorpholinomethyl benzophenone
• Methanone, (3,5-dichlorophenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

3,5-dichloro-4′-thiomorpholinomethyl benzophenone

CAS: 898783-18-1

Formula: C₁₈H₁₇Cl₂NOS

Purity: 97.0%

Molecular weight: 366.3

Ref: 10-F204527