CAS 898783-19-2

Methanone, (2,6-dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2,6-dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,6-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, contributing to its hydrophobic characteristics. Additionally, the compound features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, suggesting potential for biological activity and interaction with various receptors. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while its piperazine component may enhance its solubility in polar solvents. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of functional groups that can participate in various chemical reactions. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.

Formula: C₂₁H₂₆N₂O

InChI: InChI=1S/C21H26N2O/c1-16-7-6-8-17(2)20(16)21(24)19-10-5-4-9-18(19)15-23-13-11-22(3)12-14-23/h4-10H,11-15H2,1-3H3

InChI key: InChIKey=YHSYINUUNGUDOQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=C(C)C=CC=C3C

Synonyms:

• 2,6-Dimethyl-2′-(4-methylpiperazinomethyl) benzophenone
• (2,6-Dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (2,6-dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

2,6-dimethyl-2′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-19-2

Formula: C₂₁H₂₆N₂O

Purity: 97.0%

Molecular weight: 322.452

Ref: 10-F205475