CAS 898783-21-6

Methanone, (3,4-dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, enhancing its hydrophobic characteristics. Additionally, the compound features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, contributing to its potential biological activity and solubility properties. This compound may exhibit various pharmacological effects due to its structural components, making it of interest in medicinal chemistry. Its CAS number, 898783-21-6, allows for precise identification in chemical databases. Overall, the unique combination of functional groups and structural features suggests potential applications in drug development or as a research chemical, although specific biological activities and properties would require further investigation through empirical studies.

Formula: C₂₁H₂₆N₂O

InChI: InChI=1S/C21H26N2O/c1-16-8-9-18(14-17(16)2)21(24)20-7-5-4-6-19(20)15-23-12-10-22(3)11-13-23/h4-9,14H,10-13,15H2,1-3H3

InChI key: InChIKey=BAJFXABCJIGHKM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=CC(C)=C(C)C=C3

Synonyms:

• Methanone, (3,4-dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• 3,4-Dimethyl-2′-(4-methylpiperazinomethyl) benzophenone
• (3,4-Dimethylphenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone