CAS 898783-22-7

(3,4-difluorophenyl)-[4-(thiomorpholinomethyl)phenyl]methanone

Description:

(3,4-Difluorophenyl)-[4-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898783-22-7, is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group and a thiomorpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential biological activity. The presence of fluorine atoms often enhances lipophilicity and metabolic stability, while the thiomorpholine moiety may impart unique pharmacological properties. The compound is likely to be solid at room temperature, with a specific melting point and solubility profile that depend on the solvent used. Its chemical reactivity may include participation in nucleophilic substitutions or electrophilic aromatic substitutions, making it of interest in medicinal chemistry and drug development. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various biological pathways.

Formula: C₁₈H₁₇F₂NOS

InChI: InChI=1/C18H17F2NOS/c19-16-6-5-15(11-17(16)20)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

SMILES: c1cc(ccc1CN1CCSCC1)C(=O)c1ccc(c(c1)F)F