CAS 898783-28-3

cyclopropyl-[4-(thiomorpholinomethyl)phenyl]methanone

Description:

Cyclopropyl-[4-(thiomorpholinomethyl)phenyl]methanone is a chemical compound characterized by its unique structural features, including a cyclopropyl group and a thiomorpholine moiety. The presence of the cyclopropyl group contributes to its rigidity and may influence its reactivity and interaction with biological targets. The thiomorpholine ring, which contains sulfur, can enhance the compound's pharmacological properties, potentially affecting its solubility and binding affinity. The phenyl group attached to the thiomorpholine adds to the compound's aromatic character, which can play a significant role in its electronic properties and interactions. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its synthesis, stability, and interactions with various biological systems. Overall, cyclopropyl-[4-(thiomorpholinomethyl)phenyl]methanone represents a complex structure that could be explored for potential therapeutic uses.

Formula: C₁₅H₁₉NOS

InChI: InChI=1/C15H19NOS/c17-15(14-5-6-14)13-3-1-12(2-4-13)11-16-7-9-18-10-8-16/h1-4,14H,5-11H2

SMILES: c1cc(ccc1CN1CCSCC1)C(=O)C1CC1

cyclopropyl 4-(thiomorpholinomethyl)phenyl ketone

CAS: 898783-28-3

Formula: C₁₅H₁₉NOS

Purity: 97.0%

Molecular weight: 261.38

Ref: 10-F204532