CAS 898783-29-4

Methanone, (3-chloro-4-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique reactivity and potential biological activity. The compound also features a piperazine moiety, which is known for its role in pharmacology, often enhancing the compound's ability to interact with biological targets. This substance is likely to exhibit moderate to high lipophilicity due to its aromatic components, influencing its solubility and permeability in biological systems. Additionally, the presence of nitrogen in the piperazine ring may impart basic properties, affecting its interaction with acids and bases. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₁₉H₂₀ClFN₂O

InChI: InChI=1S/C19H20ClFN2O/c1-22-8-10-23(11-9-22)13-15-4-2-3-5-16(15)19(24)14-6-7-18(21)17(20)12-14/h2-7,12H,8-11,13H2,1H3

InChI key: InChIKey=FZUUSZYUQMIJQR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCN(C)CC2)C=CC=C1)C3=CC(Cl)=C(F)C=C3

Synonyms:

• 3-Chloro-4-fluoro-2′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (3-chloro-4-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

3-chloro-4-fluoro-2′-(4-methylpiperazinomethyl) benzophenone

CAS: 898783-29-4

Formula: C₁₉H₂₀ClFN₂O

Purity: 97.0%

Molecular weight: 346.83

Ref: 10-F205480