CAS 898783-30-7
:cyclobutyl-[4-(thiomorpholinomethyl)phenyl]methanone
Description:
Cyclobutyl-[4-(thiomorpholinomethyl)phenyl]methanone is a chemical compound characterized by its unique structure, which includes a cyclobutyl group and a phenyl ring substituted with a thiomorpholinomethyl group. This compound typically exhibits properties associated with both cyclic and aromatic systems, such as potential rigidity and stability due to the cyclobutyl moiety. The presence of the thiomorpholine ring introduces heteroatoms, which can influence its reactivity and solubility in various solvents. The methanone functional group suggests that it may participate in typical carbonyl chemistry, including nucleophilic addition reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on the context of its use, including potential therapeutic effects or mechanisms of action. Overall, cyclobutyl-[4-(thiomorpholinomethyl)phenyl]methanone represents a complex organic molecule with diverse chemical characteristics.
Formula:C16H21NOS
InChI:InChI=1/C16H21NOS/c18-16(14-2-1-3-14)15-6-4-13(5-7-15)12-17-8-10-19-11-9-17/h4-7,14H,1-3,8-12H2
SMILES:C1CC(C1)C(=O)c1ccc(cc1)CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.