CAS 898783-31-8
:(2-chlorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone
Description:
The chemical substance known as (2-chlorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898783-31-8, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chlorophenyl group may enhance lipophilicity, influencing its solubility and permeability in biological systems. The piperazine ring is known for its role in pharmacological activity, often contributing to interactions with neurotransmitter receptors. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. Its molecular structure suggests potential for various chemical reactions, making it a candidate for further research in drug design and synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C19H21ClN2O
InChI:InChI=1/C19H21ClN2O/c1-21-10-12-22(13-11-21)14-15-6-2-3-7-16(15)19(23)17-8-4-5-9-18(17)20/h2-9H,10-14H2,1H3
SMILES:CN1CCN(CC1)Cc1ccccc1C(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.