CAS 898783-32-9

Cyclopentyl[4-(4-thiomorpholinylmethyl)phenyl]methanone

Description:

Cyclopentyl[4-(4-thiomorpholinylmethyl)phenyl]methanone, identified by its CAS number 898783-32-9, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyclopentyl group and a phenyl ring substituted with a thiomorpholine moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The thiomorpholine ring may impart specific biological activities, making this compound of interest in medicinal chemistry and drug development. Its molecular design suggests potential applications in various fields, including pharmaceuticals, where it may serve as a lead compound for further modifications. Additionally, the presence of sulfur in the thiomorpholine structure can influence the compound's electronic properties and interactions with biological targets. Overall, Cyclopentyl[4-(4-thiomorpholinylmethyl)phenyl]methanone represents a complex chemical entity with potential utility in research and development.

Formula: C₁₇H₂₃NOS

InChI: InChI=1S/C17H23NOS/c19-17(15-3-1-2-4-15)16-7-5-14(6-8-16)13-18-9-11-20-12-10-18/h5-8,15H,1-4,9-13H2

InChI key: InChIKey=HLCYAEQJQANUBC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCSCC2)C=C1)C3CCCC3

Synonyms:

• Methanone, cyclopentyl[4-(4-thiomorpholinylmethyl)phenyl]-
• Cyclopentyl[4-(4-thiomorpholinylmethyl)phenyl]methanone

cyclopentyl 4-(thiomorpholinomethyl)phenyl ketone

CAS: 898783-32-9

Formula: C₁₇H₂₃NOS

Purity: 97.0%

Molecular weight: 289.44

Ref: 10-F204534