CAS 898783-34-1
:Cyclohexyl[4-(4-thiomorpholinylmethyl)phenyl]methanone
Description:
Cyclohexyl[4-(4-thiomorpholinylmethyl)phenyl]methanone, identified by its CAS number 898783-34-1, is a chemical compound characterized by its unique structural features. It contains a cyclohexyl group, which contributes to its hydrophobic properties, and a phenyl ring substituted with a thiomorpholine moiety, enhancing its potential for biological activity. The presence of the thiomorpholine group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate solubility in organic solvents due to its lipophilic nature, while its molecular structure may influence its reactivity and stability. Additionally, the presence of a ketone functional group indicates potential for further chemical modifications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C18H25NOS
InChI:InChI=1S/C18H25NOS/c20-18(16-4-2-1-3-5-16)17-8-6-15(7-9-17)14-19-10-12-21-13-11-19/h6-9,16H,1-5,10-14H2
InChI key:InChIKey=FNYRLOFGBBVSAO-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCSCC2)C=C1)C3CCCCC3
Synonyms:- Cyclohexyl[4-(4-thiomorpholinylmethyl)phenyl]methanone
- Methanone, cyclohexyl[4-(4-thiomorpholinylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.