CymitQuimica logo

CAS 898783-39-6

:

ethyl 6-oxo-6-[4-(thiomorpholinomethyl)phenyl]hexanoate

Description:
Ethyl 6-oxo-6-[4-(thiomorpholinomethyl)phenyl]hexanoate is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a thiomorpholine moiety. This compound features a hexanoate backbone with a ketone functional group at the 6-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the thiomorpholinomethyl group suggests potential biological activity, as thiomorpholines are often associated with pharmacological properties. The compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and purity. Its solubility may vary in different solvents, which is important for its application in chemical reactions or as a pharmaceutical intermediate. Safety data should be consulted for handling, as compounds with similar structures can exhibit toxicity or irritant properties. Overall, ethyl 6-oxo-6-[4-(thiomorpholinomethyl)phenyl]hexanoate represents a versatile structure in medicinal chemistry and organic synthesis.
Formula:C19H27NO3S
InChI:InChI=1/C19H27NO3S/c1-2-23-19(22)6-4-3-5-18(21)17-9-7-16(8-10-17)15-20-11-13-24-14-12-20/h7-10H,2-6,11-15H2,1H3
SMILES:CCOC(=O)CCCCC(=O)c1ccc(cc1)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.