CymitQuimica logo

CAS 898783-43-2

:

Methanone, (2-methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:
Methanone, (2-methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a piperazine moiety suggests potential biological activity, as piperazines are often found in pharmaceuticals and can interact with various biological targets. This compound features a 2-methylphenyl group and a 4-methyl-1-piperazinyl group, indicating that it may exhibit lipophilic properties, which can influence its solubility and permeability in biological systems. The molecular structure implies potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the compound's stability and reactivity would depend on the substituents on the aromatic rings and the piperazine, which can affect its interaction with other molecules. Overall, Methanone, (2-methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- represents a class of compounds that may have significant implications in drug design and development.
Formula:C20H24N2O
InChI:InChI=1S/C20H24N2O/c1-16-5-3-4-6-19(16)20(23)18-9-7-17(8-10-18)15-22-13-11-21(2)12-14-22/h3-10H,11-15H2,1-2H3
InChI key:InChIKey=QHUGMTNDWGBYSA-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCN(C)CC2)C=C1)C3=C(C)C=CC=C3
Synonyms:
  • Methanone, (2-methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-
  • 2-Methyl-4′-(4-methylpiperazinomethyl )benzophenone
  • (2-Methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.