CAS 898783-45-4

Methanone, (4-methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a piperazine moiety suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. This compound features a 4-methylphenyl group and a 4-methyl-1-piperazinyl group, indicating that it may exhibit lipophilic characteristics, which can influence its solubility and interaction with biological membranes. The molecular structure likely contributes to its potential as a ligand in medicinal chemistry, particularly in the development of pharmaceuticals targeting various receptors. Additionally, the presence of multiple functional groups may allow for diverse reactivity and synthesis pathways. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other reactants. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.

Formula: C₂₀H₂₄N₂O

InChI: InChI=1S/C20H24N2O/c1-16-3-7-18(8-4-16)20(23)19-9-5-17(6-10-19)15-22-13-11-21(2)12-14-22/h3-10H,11-15H2,1-2H3

InChI key: InChIKey=CMMYPCBUNFCECP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCN(C)CC2)C=C1)C3=CC=C(C)C=C3

Synonyms:

• (4-Methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (4-methylphenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• 4-Methyl-4′-(4-methylpiperazinomethyl )benzophenone