CAS 898783-50-1

3-[4-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzonitrile

Description:

3-[4-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzonitrile, with the CAS number 898783-50-1, is a chemical compound that belongs to the class of organic molecules known as benzamides. This compound features a complex structure that includes a benzoyl group and a benzonitrile moiety, which contribute to its potential biological activity. The presence of a piperazine ring, specifically substituted with a methyl group, suggests that it may interact with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological systems. Additionally, the nitrile functional group may impart specific reactivity or binding characteristics. Overall, this compound's unique structural features may make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₂₀H₂₁N₃O

InChI: InChI=1/C20H21N3O/c1-22-9-11-23(12-10-22)15-16-5-7-18(8-6-16)20(24)19-4-2-3-17(13-19)14-21/h2-8,13H,9-12,15H2,1H3

SMILES: CN1CCN(CC1)Cc1ccc(cc1)C(=O)c1cccc(c1)C#N